Mauveine: Enumerating the Facts

  1. This article cites DOI: 10.1039/CT8793500717 (Author: Perkin)
    1. Transcluded Properties of Mauveine:
      1. The Molecular formula is C27H24N4
      2. The Molecular weight is measured as 406.4 Daltons
        1. C27H24N4 requires 404.2 Daltons
        2. Δ +2.2 acceptable error limit
    2. Transcluded Properties of Mauveine:
      1. Reaction with Lead Dioxide
        1. Attribute: Oxidant
        2. Attribute: Chemoselective
          • Oxidized_group: HN-aryl
      2. Reaction with Zn Dust
        1. Attribute: Reductant
        2. Attribute: Chemoselective
          • Reduced_group: NO2
      3. Reaction_Product: Parasafranine
    3. Transcluded Properties of Parasafranine:
      1. The Molecular formula is C20H18N4
      2. Molecular formulae of Mauveine and Parasafranine differ by C7H6
      3. Safranine and Parasafranine are related by Molecular_Isomerism.
  2. This article cites DOI: 10.1021/ja042233m (Author: Wuest)
    1. Transcluded Properties of Safranine:
      1. InChI=1/C20H18N4/c1-12-8-17-19(10-15(12)21)24(14-6-4-3-5-7-14)20-11-16(22)13(2)9-18(20)23-17/h3-11,21H,22H2,1-2H3
  3. This article cites DOI: XXX (Author: Shulz)
    1. Transcluded Properties of Mauveine:
      1. InChI=1/C27H24N4/c1-17-9-11-21(12-10-17)31-26-15-22(28)18(2)13-24(26)30-25-14-19(3)23(16-27(25)31)29-20-7-5-4-6-8-20/h4-16H,28H2,1-3H3/b29-23-
      2. Sub-structure contains HN-Phenyl
      3. Molecular formulae of Mauveine and Parasafranine differ by C6H4

© H. S. Rzepa, 2007.