Mauveine: Inferring the Facts

  1. The facts known to the present article allow the following inferences:
    1. Statements 1.3.2 and 3.1.3 are inconsistent!
  2. This article cites DOI: 10.1039/P19940000005 (Author: Meth-Cohn)
    1. Properties of Mauveine transcluded from Meth-Cohn:
      1. InChI=1/C27H24N4/c1-17-9-11-20(12-10-17)29-21-13-19(3)27-26(15-21)31(22-7-5-4-6-8-22)25-16-23(28)18(2)14-24(25)30-27/h4-16H,28H2,1-3H3/b29-21+
      2. Sub-structure contains HN-Tolyl
      3. Molecular formulae of Mauveine and Parasafranine differ by C7H6
  3. The facts known to the present article allow the following inferences:
    1. Statements 1.3.2 and 5.1.3 are consistent
    2. Using Statements 1.3.3, 2.1.1 and 3.1.1, it is possible to predict a structure for Parasafranine:
      • InChI=1/C20H18N4/c1-12-9-17-18(11-16(12)22)24(15-6-4-3-5-7-15)19-10-14(21)8-13(2)20(19)23-17/h3-11,21H,22H2,1-2H3
    3. Statement 6.2 can be verified by experiment!

© H. S. Rzepa, 2007.